C12H18O3 — CID 92859928
(1S)-1-(4-methoxyphenyl)pentane-1,5-diol (PubChem CID 92859928) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is (1S)-1-(4-methoxyphenyl)pentane-1,5-diol.
| Compound Name | (1S)-1-(4-methoxyphenyl)pentane-1,5-diol |
|---|---|
| PubChem CID | 92859928 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (1S)-1-(4-methoxyphenyl)pentane-1,5-diol |
| SMILES | COc1ccc([C@@H](O)CCCCO)cc1 |
| InChI | InChI=1S/C12H18O3/c1-15-11-7-5-10(6-8-11)12(14)4-2-3-9-13/h5-8,12-14H,2-4,9H2,1H3/t12-/m0/s1 |
| InChIKey | HCMQBEAFBDZDFZ-LBPRGKRZSA-N |
| XLogP | 1.89 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|