C10H13ClO3 — CID 10420893
2-chloro-1-(4-methoxyphenyl)propane-1,3-diol (PubChem CID 10420893) has the molecular formula C10H13ClO3 and a molecular weight of 216.66 g/mol. Its IUPAC name is 2-chloro-1-(4-methoxyphenyl)propane-1,3-diol.
| Compound Name | 2-chloro-1-(4-methoxyphenyl)propane-1,3-diol |
|---|---|
| PubChem CID | 10420893 |
| Molecular Formula | C10H13ClO3 |
| Molecular Weight | 216.66 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 2-chloro-1-(4-methoxyphenyl)propane-1,3-diol |
| SMILES | COc1ccc(C(O)C(Cl)CO)cc1 |
| InChI | InChI=1S/C10H13ClO3/c1-14-8-4-2-7(3-5-8)10(13)9(11)6-12/h2-5,9-10,12-13H,6H2,1H3 |
| InChIKey | XLCIIYDQKWPMNM-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.66 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|