C10H13N3O3 — CID 121485278
2-azido-1-(4-methoxyphenyl)propane-1,3-diol (PubChem CID 121485278) has the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. Its IUPAC name is 2-azido-1-(4-methoxyphenyl)propane-1,3-diol.
| Compound Name | 2-azido-1-(4-methoxyphenyl)propane-1,3-diol |
|---|---|
| PubChem CID | 121485278 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 2-azido-1-(4-methoxyphenyl)propane-1,3-diol |
| SMILES | COc1ccc(C(O)C(CO)N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C10H13N3O3/c1-16-8-4-2-7(3-5-8)10(15)9(6-14)12-13-11/h2-5,9-10,14-15H,6H2,1H3 |
| InChIKey | HHIIATBBZLPMAP-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 98.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|