C11H14N4OS — CID 10514834
2-azido-2-(4-methoxyphenyl)-N,N-dimethylethanethioamide (PubChem CID 10514834) has the molecular formula C11H14N4OS and a molecular weight of 250.33 g/mol. Its IUPAC name is 2-azido-2-(4-methoxyphenyl)-N,N-dimethylethanethioamide.
| Compound Name | 2-azido-2-(4-methoxyphenyl)-N,N-dimethylethanethioamide |
|---|---|
| PubChem CID | 10514834 |
| Molecular Formula | C11H14N4OS |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 2-azido-2-(4-methoxyphenyl)-N,N-dimethylethanethioamide |
| SMILES | COc1ccc(C(N=[N+]=[N-])C(=S)N(C)C)cc1 |
| InChI | InChI=1S/C11H14N4OS/c1-15(2)11(17)10(13-14-12)8-4-6-9(16-3)7-5-8/h4-7,10H,1-3H3 |
| InChIKey | IWLDTILABJSXPZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 61.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|