C15H30NNaO5S2 — CID 102527026
sodium N-octyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]carbamodithioate (PubChem CID 102527026) has the molecular formula C15H30NNaO5S2 and a molecular weight of 391.53 g/mol. Its IUPAC name is sodium N-octyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]carbamodithioate.
| Compound Name | sodium N-octyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]carbamodithioate |
|---|---|
| PubChem CID | 102527026 |
| Molecular Formula | C15H30NNaO5S2 |
| Molecular Weight | 391.53 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | sodium N-octyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]carbamodithioate |
| SMILES | CCCCCCCCN(C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C(=S)[S-].[Na+] |
| InChI | InChI=1S/C15H31NO5S2.Na/c1-2-3-4-5-6-7-8-16(15(22)23)9-11(18)13(20)14(21)12(19)10-17;/h11-14,17-21H,2-10H2,1H3,(H,22,23);/q;+1/p-1/t11-,12+,13+,14+;/m0./s1 |
| InChIKey | QRFCJKQPGCSHBR-PKJCYYJESA-M |
| XLogP | -3.08 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.53 |
| LogP ≤ 5 | -3.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|