C13H26NNaS2 — CID 23671974
sodium N,N-dihexylcarbamodithioate (PubChem CID 23671974) has the molecular formula C13H26NNaS2 and a molecular weight of 283.48 g/mol. Its IUPAC name is sodium N,N-dihexylcarbamodithioate.
| Compound Name | sodium N,N-dihexylcarbamodithioate |
|---|---|
| PubChem CID | 23671974 |
| Molecular Formula | C13H26NNaS2 |
| Molecular Weight | 283.48 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | sodium N,N-dihexylcarbamodithioate |
| SMILES | CCCCCCN(CCCCCC)C(=S)[S-].[Na+] |
| InChI | InChI=1S/C13H27NS2.Na/c1-3-5-7-9-11-14(13(15)16)12-10-8-6-4-2;/h3-12H2,1-2H3,(H,15,16);/q;+1/p-1 |
| InChIKey | QEXSIPMRPUULGY-UHFFFAOYSA-M |
| XLogP | 1.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.48 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|