C18H36N2NiS4 — CID 4523766
bis(N,N-dibutylcarbamodithioate);nickel(2+) (PubChem CID 4523766) has the molecular formula C18H36N2NiS4 and a molecular weight of 467.46 g/mol. Its IUPAC name is bis(N,N-dibutylcarbamodithioate);nickel(2+).
| Compound Name | bis(N,N-dibutylcarbamodithioate);nickel(2+) |
|---|---|
| PubChem CID | 4523766 |
| Molecular Formula | C18H36N2NiS4 |
| Molecular Weight | 467.46 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | bis(N,N-dibutylcarbamodithioate);nickel(2+) |
| SMILES | CCCCN(CCCC)C(=S)[S-].CCCCN(CCCC)C(=S)[S-].[Ni+2] |
| InChI | InChI=1S/2C9H19NS2.Ni/c2*1-3-5-7-10(9(11)12)8-6-4-2;/h2*3-8H2,1-2H3,(H,11,12);/q;;+2/p-2 |
| InChIKey | HPOWMHUJHHIQGP-UHFFFAOYSA-L |
| XLogP | 5.44 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.46 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|