C11H23NNiS2 — CID 162055102
N,N-dibutylcarbamodithioate;ethane;nickel(2+) (PubChem CID 162055102) has the molecular formula C11H23NNiS2 and a molecular weight of 292.14 g/mol. Its IUPAC name is N,N-dibutylcarbamodithioate;ethane;nickel(2+).
| Compound Name | N,N-dibutylcarbamodithioate;ethane;nickel(2+) |
|---|---|
| PubChem CID | 162055102 |
| Molecular Formula | C11H23NNiS2 |
| Molecular Weight | 292.14 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | N,N-dibutylcarbamodithioate;ethane;nickel(2+) |
| SMILES | CCCCN(CCCC)C(=S)[S-].[CH2-]C.[Ni+2] |
| InChI | InChI=1S/C9H19NS2.C2H5.Ni/c1-3-5-7-10(9(11)12)8-6-4-2;1-2;/h3-8H2,1-2H3,(H,11,12);1H2,2H3;/q;-1;+2/p-1 |
| InChIKey | YZBLXAQPCRDABH-UHFFFAOYSA-M |
| XLogP | 3.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.14 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|