C23H46N2S4Zn — CID 523463
zinc;2-(dipentylamino)ethanedithioate;N,N-dipentylcarbamodithioate (PubChem CID 523463) has the molecular formula C23H46N2S4Zn and a molecular weight of 544.29 g/mol. Its IUPAC name is zinc;2-(dipentylamino)ethanedithioate;N,N-dipentylcarbamodithioate.
| Compound Name | zinc;2-(dipentylamino)ethanedithioate;N,N-dipentylcarbamodithioate |
|---|---|
| PubChem CID | 523463 |
| Molecular Formula | C23H46N2S4Zn |
| Molecular Weight | 544.29 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | zinc;2-(dipentylamino)ethanedithioate;N,N-dipentylcarbamodithioate |
| SMILES | CCCCCN(CCCCC)C(=S)[S-].CCCCCN(CCCCC)CC(=S)[S-].[Zn+2] |
| InChI | InChI=1S/C12H25NS2.C11H23NS2.Zn/c1-3-5-7-9-13(11-12(14)15)10-8-6-4-2;1-3-5-7-9-12(11(13)14)10-8-6-4-2;/h3-11H2,1-2H3,(H,14,15);3-10H2,1-2H3,(H,13,14);/q;;+2/p-2 |
| InChIKey | ATDAFKHZUZYDHX-UHFFFAOYSA-L |
| XLogP | 7.04 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.29 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|