C18H39NO5 — CID 72549336
6-[methyl(undecyl)amino]hexane-1,2,3,4,5-pentol (PubChem CID 72549336) has the molecular formula C18H39NO5 and a molecular weight of 349.51 g/mol. Its IUPAC name is 6-[methyl(undecyl)amino]hexane-1,2,3,4,5-pentol.
| Compound Name | 6-[methyl(undecyl)amino]hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 72549336 |
| Molecular Formula | C18H39NO5 |
| Molecular Weight | 349.51 g/mol |
| Exact Mass | 349.28 |
| IUPAC Name | 6-[methyl(undecyl)amino]hexane-1,2,3,4,5-pentol |
| SMILES | CCCCCCCCCCCN(C)CC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C18H39NO5/c1-3-4-5-6-7-8-9-10-11-12-19(2)13-15(21)17(23)18(24)16(22)14-20/h15-18,20-24H,3-14H2,1-2H3 |
| InChIKey | PSOCUDPSWNBOHL-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.51 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|