C14H29NO6 — CID 3634985
N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)heptanamide (PubChem CID 3634985) has the molecular formula C14H29NO6 and a molecular weight of 307.39 g/mol. Its IUPAC name is N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)heptanamide.
| Compound Name | N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)heptanamide |
|---|---|
| PubChem CID | 3634985 |
| Molecular Formula | C14H29NO6 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)heptanamide |
| SMILES | CCCCCCC(=O)N(C)CC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C14H29NO6/c1-3-4-5-6-7-12(19)15(2)8-10(17)13(20)14(21)11(18)9-16/h10-11,13-14,16-18,20-21H,3-9H2,1-2H3 |
| InChIKey | VHYYJWLKCODCNM-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 121.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|