C24H49NO7 — CID 24760195
2-hexyldecyl N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)carbamate (PubChem CID 24760195) has the molecular formula C24H49NO7 and a molecular weight of 463.66 g/mol. Its IUPAC name is 2-hexyldecyl N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)carbamate.
| Compound Name | 2-hexyldecyl N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)carbamate |
|---|---|
| PubChem CID | 24760195 |
| Molecular Formula | C24H49NO7 |
| Molecular Weight | 463.66 g/mol |
| Exact Mass | 463.35 |
| IUPAC Name | 2-hexyldecyl N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)carbamate |
| SMILES | CCCCCCCCC(CCCCCC)COC(=O)N(C)CC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C24H49NO7/c1-4-6-8-10-11-13-15-19(14-12-9-7-5-2)18-32-24(31)25(3)16-20(27)22(29)23(30)21(28)17-26/h19-23,26-30H,4-18H2,1-3H3 |
| InChIKey | TZYKKXBPJKIAOY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 130.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.66 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|