C48H96O18 — CID 158014556
[(2R,3R,4R,5S)-2,3,4,5,6-pentahydroxyhexyl] 9,10-dihydroxyoctadecanoate;[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl] 9,10-dihydroxyoctadecanoate (PubChem CID 158014556) has the molecular formula C48H96O18 and a molecular weight of 961.28 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-2,3,4,5,6-pentahydroxyhexyl] 9,10-dihydroxyoctadecanoate;[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl] 9,10-dihydroxyoctadecanoate.
| Compound Name | [(2R,3R,4R,5S)-2,3,4,5,6-pentahydroxyhexyl] 9,10-dihydroxyoctadecanoate;[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl] 9,10-dihydroxyoctadecanoate |
|---|---|
| PubChem CID | 158014556 |
| Molecular Formula | C48H96O18 |
| Molecular Weight | 961.28 g/mol |
| Exact Mass | 960.66 |
| IUPAC Name | [(2R,3R,4R,5S)-2,3,4,5,6-pentahydroxyhexyl] 9,10-dihydroxyoctadecanoate;[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl] 9,10-dihydroxyoctadecanoate |
| SMILES | CCCCCCCCC(O)C(O)CCCCCCCC(=O)OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO.CCCCCCCCC(O)C(O)CCCCCCCC(=O)OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/2C24H48O9/c2*1-2-3-4-5-7-10-13-18(26)19(27)14-11-8-6-9-12-15-22(30)33-17-21(29)24(32)23(31)20(28)16-25/h2*18-21,23-29,31-32H,2-17H2,1H3/t18?,19?,20-,21+,23+,24+;18?,19?,20-,21+,23-,24-/m01/s1 |
| InChIKey | FFHKVKSTKOGXNE-NRVRYCDMSA-N |
| XLogP | 2.34 |
| TPSA | 335.82 Ų |
| H-Bond Donors | 14 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 961.28 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 14 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|