C22H44O5 — CID 134251653
(3-hydroxy-2-methylpropyl) 9,10-dihydroxyoctadecanoate (PubChem CID 134251653) has the molecular formula C22H44O5 and a molecular weight of 388.59 g/mol. Its IUPAC name is (3-hydroxy-2-methylpropyl) 9,10-dihydroxyoctadecanoate.
| Compound Name | (3-hydroxy-2-methylpropyl) 9,10-dihydroxyoctadecanoate |
|---|---|
| PubChem CID | 134251653 |
| Molecular Formula | C22H44O5 |
| Molecular Weight | 388.59 g/mol |
| Exact Mass | 388.32 |
| IUPAC Name | (3-hydroxy-2-methylpropyl) 9,10-dihydroxyoctadecanoate |
| SMILES | CCCCCCCCC(O)C(O)CCCCCCCC(=O)OCC(C)CO |
| InChI | InChI=1S/C22H44O5/c1-3-4-5-6-8-11-14-20(24)21(25)15-12-9-7-10-13-16-22(26)27-18-19(2)17-23/h19-21,23-25H,3-18H2,1-2H3 |
| InChIKey | WRKPRAYYVMHQPK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.59 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|