C25H49NO6 — CID 122549810
(Z)-N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)octadec-9-enamide (PubChem CID 122549810) has the molecular formula C25H49NO6 and a molecular weight of 459.67 g/mol. Its IUPAC name is (Z)-N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)octadec-9-enamide.
| Compound Name | (Z)-N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)octadec-9-enamide |
|---|---|
| PubChem CID | 122549810 |
| Molecular Formula | C25H49NO6 |
| Molecular Weight | 459.67 g/mol |
| Exact Mass | 459.36 |
| IUPAC Name | (Z)-N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)octadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N(C)CC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C25H49NO6/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23(30)26(2)19-21(28)24(31)25(32)22(29)20-27/h10-11,21-22,24-25,27-29,31-32H,3-9,12-20H2,1-2H3/b11-10- |
| InChIKey | YFKXAXGUBUXIHM-KHPPLWFESA-N |
| XLogP | 2.92 |
| TPSA | 121.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.67 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|