C36H69N3O13 — CID 101086773
(E)-N,N-bis[3-[[(2R,3S,4R,5S)-2,3,4,5,6-pentahydroxyhexanoyl]amino]propyl]octadec-8-enamide (PubChem CID 101086773) has the molecular formula C36H69N3O13 and a molecular weight of 751.96 g/mol. Its IUPAC name is (E)-N,N-bis[3-[[(2R,3S,4R,5S)-2,3,4,5,6-pentahydroxyhexanoyl]amino]propyl]octadec-8-enamide.
| Compound Name | (E)-N,N-bis[3-[[(2R,3S,4R,5S)-2,3,4,5,6-pentahydroxyhexanoyl]amino]propyl]octadec-8-enamide |
|---|---|
| PubChem CID | 101086773 |
| Molecular Formula | C36H69N3O13 |
| Molecular Weight | 751.96 g/mol |
| Exact Mass | 751.48 |
| IUPAC Name | (E)-N,N-bis[3-[[(2R,3S,4R,5S)-2,3,4,5,6-pentahydroxyhexanoyl]amino]propyl]octadec-8-enamide |
| SMILES | CCCCCCCCC/C=C/CCCCCCC(=O)N(CCCNC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO)CCCNC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C36H69N3O13/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-28(44)39(22-17-20-37-35(51)33(49)31(47)29(45)26(42)24-40)23-18-21-38-36(52)34(50)32(48)30(46)27(43)25-41/h10-11,26-27,29-34,40-43,45-50H,2-9,12-25H2,1H3,(H,37,51)(H,38,52)/b11-10+/t26-,27-,29+,30+,31-,32-,33+,34+/m0/s1 |
| InChIKey | FVCBIDGEAWDAKI-KBGDFKFJSA-N |
| XLogP | -1.26 |
| TPSA | 280.81 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.96 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|