C13H27NO5 — CID 175982166
(2R,3S,4S)-2,3,4,5-tetrahydroxy-N-octylpentanamide (PubChem CID 175982166) has the molecular formula C13H27NO5 and a molecular weight of 277.36 g/mol. Its IUPAC name is (2R,3S,4S)-2,3,4,5-tetrahydroxy-N-octylpentanamide.
| Compound Name | (2R,3S,4S)-2,3,4,5-tetrahydroxy-N-octylpentanamide |
|---|---|
| PubChem CID | 175982166 |
| Molecular Formula | C13H27NO5 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | (2R,3S,4S)-2,3,4,5-tetrahydroxy-N-octylpentanamide |
| SMILES | CCCCCCCCNC(=O)[C@H](O)[C@@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C13H27NO5/c1-2-3-4-5-6-7-8-14-13(19)12(18)11(17)10(16)9-15/h10-12,15-18H,2-9H2,1H3,(H,14,19)/t10-,11-,12+/m0/s1 |
| InChIKey | CWGVJAUDXFRDIK-SDDRHHMPSA-N |
| XLogP | -0.46 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|