C16H32N2O4 — CID 11392932
(2R,3R)-N,N'-dihexyl-2,3-dihydroxybutanediamide (PubChem CID 11392932) has the molecular formula C16H32N2O4 and a molecular weight of 316.44 g/mol. Its IUPAC name is (2R,3R)-N,N'-dihexyl-2,3-dihydroxybutanediamide.
| Compound Name | (2R,3R)-N,N'-dihexyl-2,3-dihydroxybutanediamide |
|---|---|
| PubChem CID | 11392932 |
| Molecular Formula | C16H32N2O4 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | (2R,3R)-N,N'-dihexyl-2,3-dihydroxybutanediamide |
| SMILES | CCCCCCNC(=O)[C@H](O)[C@@H](O)C(=O)NCCCCCC |
| InChI | InChI=1S/C16H32N2O4/c1-3-5-7-9-11-17-15(21)13(19)14(20)16(22)18-12-10-8-6-4-2/h13-14,19-20H,3-12H2,1-2H3,(H,17,21)(H,18,22)/t13-,14-/m1/s1 |
| InChIKey | MGOXOOYKQVWSBA-ZIAGYGMSSA-N |
| XLogP | 1.10 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|