C24H46N4O6 — CID 139749513
(2R,3R)-2,3-dihydroxy-N,N'-bis[2-(octanoylamino)ethyl]butanediamide (PubChem CID 139749513) has the molecular formula C24H46N4O6 and a molecular weight of 486.65 g/mol. Its IUPAC name is (2R,3R)-2,3-dihydroxy-N,N'-bis[2-(octanoylamino)ethyl]butanediamide.
| Compound Name | (2R,3R)-2,3-dihydroxy-N,N'-bis[2-(octanoylamino)ethyl]butanediamide |
|---|---|
| PubChem CID | 139749513 |
| Molecular Formula | C24H46N4O6 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.34 |
| IUPAC Name | (2R,3R)-2,3-dihydroxy-N,N'-bis[2-(octanoylamino)ethyl]butanediamide |
| SMILES | CCCCCCCC(=O)NCCNC(=O)[C@H](O)[C@@H](O)C(=O)NCCNC(=O)CCCCCCC |
| InChI | InChI=1S/C24H46N4O6/c1-3-5-7-9-11-13-19(29)25-15-17-27-23(33)21(31)22(32)24(34)28-18-16-26-20(30)14-12-10-8-6-4-2/h21-22,31-32H,3-18H2,1-2H3,(H,25,29)(H,26,30)(H,27,33)(H,28,34)/t21-,22-/m1/s1 |
| InChIKey | JLKPCEIBAJWXLI-FGZHOGPDSA-N |
| XLogP | 0.89 |
| TPSA | 156.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|