C15H30N2O12 — CID 14403953
(2R,3R,4S,5R)-2,3,4,5,6-pentahydroxy-N-[3-[[(2R,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]propyl]hexanamide (PubChem CID 14403953) has the molecular formula C15H30N2O12 and a molecular weight of 430.41 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2,3,4,5,6-pentahydroxy-N-[3-[[(2R,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]propyl]hexanamide.
| Compound Name | (2R,3R,4S,5R)-2,3,4,5,6-pentahydroxy-N-[3-[[(2R,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]propyl]hexanamide |
|---|---|
| PubChem CID | 14403953 |
| Molecular Formula | C15H30N2O12 |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | (2R,3R,4S,5R)-2,3,4,5,6-pentahydroxy-N-[3-[[(2R,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]propyl]hexanamide |
| SMILES | O=C(NCCCNC(=O)[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO)[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C15H30N2O12/c18-4-6(20)8(22)10(24)12(26)14(28)16-2-1-3-17-15(29)13(27)11(25)9(23)7(21)5-19/h6-13,18-27H,1-5H2,(H,16,28)(H,17,29)/t6-,7-,8+,9+,10-,11-,12-,13-/m1/s1 |
| InChIKey | TTZVMLCNXWOBGT-ZLVHXUGRSA-N |
| XLogP | -7.52 |
| TPSA | 260.50 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | -7.52 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|