C10H23NO6 — CID 144926346
ethane;N-ethyl-2,3,4,5,6-pentahydroxyhexanamide (PubChem CID 144926346) has the molecular formula C10H23NO6 and a molecular weight of 253.29 g/mol. Its IUPAC name is ethane;N-ethyl-2,3,4,5,6-pentahydroxyhexanamide.
| Compound Name | ethane;N-ethyl-2,3,4,5,6-pentahydroxyhexanamide |
|---|---|
| PubChem CID | 144926346 |
| Molecular Formula | C10H23NO6 |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | ethane;N-ethyl-2,3,4,5,6-pentahydroxyhexanamide |
| SMILES | CC.CCNC(=O)C(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C8H17NO6.C2H6/c1-2-9-8(15)7(14)6(13)5(12)4(11)3-10;1-2/h4-7,10-14H,2-3H2,1H3,(H,9,15);1-2H3 |
| InChIKey | JURGXWZKZNORGD-UHFFFAOYSA-N |
| XLogP | -2.42 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |