C10H22N2O6 — CID 89146863
(2S,4S,5R)-N-(4-aminobutyl)-2,3,4,5,6-pentahydroxyhexanamide (PubChem CID 89146863) has the molecular formula C10H22N2O6 and a molecular weight of 266.29 g/mol. Its IUPAC name is (2S,4S,5R)-N-(4-aminobutyl)-2,3,4,5,6-pentahydroxyhexanamide.
| Compound Name | (2S,4S,5R)-N-(4-aminobutyl)-2,3,4,5,6-pentahydroxyhexanamide |
|---|---|
| PubChem CID | 89146863 |
| Molecular Formula | C10H22N2O6 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (2S,4S,5R)-N-(4-aminobutyl)-2,3,4,5,6-pentahydroxyhexanamide |
| SMILES | NCCCCNC(=O)[C@@H](O)C(O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H22N2O6/c11-3-1-2-4-12-10(18)9(17)8(16)7(15)6(14)5-13/h6-9,13-17H,1-5,11H2,(H,12,18)/t6-,7+,8?,9+/m1/s1 |
| InChIKey | SDANUOZGBACWAD-VIBJECDYSA-N |
| XLogP | -3.72 |
| TPSA | 156.27 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | -3.72 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|