C12H26N2O8 — CID 88861881
N-(4-aminobutyl)-2,3,4,5,6,7,8-heptahydroxyoctanamide (PubChem CID 88861881) has the molecular formula C12H26N2O8 and a molecular weight of 326.35 g/mol. Its IUPAC name is N-(4-aminobutyl)-2,3,4,5,6,7,8-heptahydroxyoctanamide.
| Compound Name | N-(4-aminobutyl)-2,3,4,5,6,7,8-heptahydroxyoctanamide |
|---|---|
| PubChem CID | 88861881 |
| Molecular Formula | C12H26N2O8 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | N-(4-aminobutyl)-2,3,4,5,6,7,8-heptahydroxyoctanamide |
| SMILES | NCCCCNC(=O)C(O)C(O)C(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C12H26N2O8/c13-3-1-2-4-14-12(22)11(21)10(20)9(19)8(18)7(17)6(16)5-15/h6-11,15-21H,1-5,13H2,(H,14,22) |
| InChIKey | MAMDJHUFTGCGBM-UHFFFAOYSA-N |
| XLogP | -5.00 |
| TPSA | 196.73 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | -5.00 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|