C11H24N2O6 — CID 102510568
(2R,3S,4R,5R)-N-(5-aminopentyl)-2,3,4,5,6-pentahydroxyhexanamide (PubChem CID 102510568) has the molecular formula C11H24N2O6 and a molecular weight of 280.32 g/mol. Its IUPAC name is (2R,3S,4R,5R)-N-(5-aminopentyl)-2,3,4,5,6-pentahydroxyhexanamide.
| Compound Name | (2R,3S,4R,5R)-N-(5-aminopentyl)-2,3,4,5,6-pentahydroxyhexanamide |
|---|---|
| PubChem CID | 102510568 |
| Molecular Formula | C11H24N2O6 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | (2R,3S,4R,5R)-N-(5-aminopentyl)-2,3,4,5,6-pentahydroxyhexanamide |
| SMILES | NCCCCCNC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C11H24N2O6/c12-4-2-1-3-5-13-11(19)10(18)9(17)8(16)7(15)6-14/h7-10,14-18H,1-6,12H2,(H,13,19)/t7-,8-,9+,10-/m1/s1 |
| InChIKey | HUOFPNYVRCIOHG-DOLQZWNJSA-N |
| XLogP | -3.33 |
| TPSA | 156.27 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | -3.33 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|