C16H32N2O14 — CID 102513201
(2R,3R,4S,5R,6R)-N-[2-[[(2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoyl]amino]ethyl]-2,3,4,5,6,7-hexahydroxyheptanamide (PubChem CID 102513201) has the molecular formula C16H32N2O14 and a molecular weight of 476.43 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-N-[2-[[(2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoyl]amino]ethyl]-2,3,4,5,6,7-hexahydroxyheptanamide.
| Compound Name | (2R,3R,4S,5R,6R)-N-[2-[[(2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoyl]amino]ethyl]-2,3,4,5,6,7-hexahydroxyheptanamide |
|---|---|
| PubChem CID | 102513201 |
| Molecular Formula | C16H32N2O14 |
| Molecular Weight | 476.43 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | (2R,3R,4S,5R,6R)-N-[2-[[(2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoyl]amino]ethyl]-2,3,4,5,6,7-hexahydroxyheptanamide |
| SMILES | O=C(NCCNC(=O)[C@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)[C@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C16H32N2O14/c19-3-5(21)7(23)9(25)11(27)13(29)15(31)17-1-2-18-16(32)14(30)12(28)10(26)8(24)6(22)4-20/h5-14,19-30H,1-4H2,(H,17,31)(H,18,32)/t5-,6-,7-,8-,9+,10+,11-,12-,13-,14-/m1/s1 |
| InChIKey | XWAOHCUYNWIPIW-LOUZWEESSA-N |
| XLogP | -9.19 |
| TPSA | 300.96 Ų |
| H-Bond Donors | 14 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.43 |
| LogP ≤ 5 | -9.19 |
| H-Bond Donors ≤ 5 | 14 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|