C9H15NO6 — CID 58210245
2,3,4,5,6-pentahydroxy-N-prop-2-ynylhexanamide (PubChem CID 58210245) has the molecular formula C9H15NO6 and a molecular weight of 233.22 g/mol. Its IUPAC name is 2,3,4,5,6-pentahydroxy-N-prop-2-ynylhexanamide.
| Compound Name | 2,3,4,5,6-pentahydroxy-N-prop-2-ynylhexanamide |
|---|---|
| PubChem CID | 58210245 |
| Molecular Formula | C9H15NO6 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 2,3,4,5,6-pentahydroxy-N-prop-2-ynylhexanamide |
| SMILES | C#CCNC(=O)C(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C9H15NO6/c1-2-3-10-9(16)8(15)7(14)6(13)5(12)4-11/h1,5-8,11-15H,3-4H2,(H,10,16) |
| InChIKey | IYRKSXOEDNAYKQ-UHFFFAOYSA-N |
| XLogP | -3.83 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | -3.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|