C9H17NO8 — CID 56969147
(2S)-2-(2,3,4,5,6-pentahydroxyhexanoylamino)propanoic acid (PubChem CID 56969147) has the molecular formula C9H17NO8 and a molecular weight of 267.23 g/mol. Its IUPAC name is (2S)-2-(2,3,4,5,6-pentahydroxyhexanoylamino)propanoic acid.
| Compound Name | (2S)-2-(2,3,4,5,6-pentahydroxyhexanoylamino)propanoic acid |
|---|---|
| PubChem CID | 56969147 |
| Molecular Formula | C9H17NO8 |
| Molecular Weight | 267.23 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | (2S)-2-(2,3,4,5,6-pentahydroxyhexanoylamino)propanoic acid |
| SMILES | C[C@H](NC(=O)C(O)C(O)C(O)C(O)CO)C(=O)O |
| InChI | InChI=1S/C9H17NO8/c1-3(9(17)18)10-8(16)7(15)6(14)5(13)4(12)2-11/h3-7,11-15H,2H2,1H3,(H,10,16)(H,17,18)/t3-,4?,5?,6?,7?/m0/s1 |
| InChIKey | NBXXOOCDYRGSOJ-XCASYZLESA-N |
| XLogP | -3.99 |
| TPSA | 167.55 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.23 |
| LogP ≤ 5 | -3.99 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |