C11H21NO8 — CID 7909378
(2S)-3-methyl-2-[[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]butanoic acid (PubChem CID 7909378) has the molecular formula C11H21NO8 and a molecular weight of 295.29 g/mol. Its IUPAC name is (2S)-3-methyl-2-[[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]butanoic acid.
| Compound Name | (2S)-3-methyl-2-[[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 7909378 |
| Molecular Formula | C11H21NO8 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | (2S)-3-methyl-2-[[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]butanoic acid |
| SMILES | CC(C)[C@H](NC(=O)[C@H](O)[C@H](O)[C@H](O)[C@H](O)CO)C(=O)O |
| InChI | InChI=1S/C11H21NO8/c1-4(2)6(11(19)20)12-10(18)9(17)8(16)7(15)5(14)3-13/h4-9,13-17H,3H2,1-2H3,(H,12,18)(H,19,20)/t5-,6+,7-,8-,9-/m1/s1 |
| InChIKey | ARPJJMSZXXSGRQ-ANZWQOBJSA-N |
| XLogP | -3.35 |
| TPSA | 167.55 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | -3.35 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |