C11H21NO8S — CID 99948526
(2S)-4-methylsulfanyl-2-[[(2R,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]butanoic acid (PubChem CID 99948526) has the molecular formula C11H21NO8S and a molecular weight of 327.36 g/mol. Its IUPAC name is (2S)-4-methylsulfanyl-2-[[(2R,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]butanoic acid.
| Compound Name | (2S)-4-methylsulfanyl-2-[[(2R,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 99948526 |
| Molecular Formula | C11H21NO8S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | (2S)-4-methylsulfanyl-2-[[(2R,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]butanoic acid |
| SMILES | CSCC[C@H](NC(=O)[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO)C(=O)O |
| InChI | InChI=1S/C11H21NO8S/c1-21-3-2-5(11(19)20)12-10(18)9(17)8(16)7(15)6(14)4-13/h5-9,13-17H,2-4H2,1H3,(H,12,18)(H,19,20)/t5-,6+,7-,8+,9+/m0/s1 |
| InChIKey | IJIGIXPOPAELGH-KVEIKIFDSA-N |
| XLogP | -3.26 |
| TPSA | 167.55 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | -3.26 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |