C9H17N3O5S — CID 61151608
(2S)-2-[[2-(carbamoylamino)-4-methylsulfanylbutanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 61151608) has the molecular formula C9H17N3O5S and a molecular weight of 279.32 g/mol. Its IUPAC name is (2S)-2-[[2-(carbamoylamino)-4-methylsulfanylbutanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-[[2-(carbamoylamino)-4-methylsulfanylbutanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 61151608 |
| Molecular Formula | C9H17N3O5S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | (2S)-2-[[2-(carbamoylamino)-4-methylsulfanylbutanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | CSCCC(NC(N)=O)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C9H17N3O5S/c1-18-3-2-5(12-9(10)17)7(14)11-6(4-13)8(15)16/h5-6,13H,2-4H2,1H3,(H,11,14)(H,15,16)(H3,10,12,17)/t5?,6-/m0/s1 |
| InChIKey | CMCIFTSHSHKCJQ-GDVGLLTNSA-N |
| XLogP | -1.66 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |