C11H20N4O5S — CID 107829909
(2R)-5-amino-2-[[2-(carbamoylamino)-4-methylsulfanylbutanoyl]amino]-5-oxopentanoic acid (PubChem CID 107829909) has the molecular formula C11H20N4O5S and a molecular weight of 320.37 g/mol. Its IUPAC name is (2R)-5-amino-2-[[2-(carbamoylamino)-4-methylsulfanylbutanoyl]amino]-5-oxopentanoic acid.
| Compound Name | (2R)-5-amino-2-[[2-(carbamoylamino)-4-methylsulfanylbutanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107829909 |
| Molecular Formula | C11H20N4O5S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | (2R)-5-amino-2-[[2-(carbamoylamino)-4-methylsulfanylbutanoyl]amino]-5-oxopentanoic acid |
| SMILES | CSCCC(NC(N)=O)C(=O)N[C@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C11H20N4O5S/c1-21-5-4-6(15-11(13)20)9(17)14-7(10(18)19)2-3-8(12)16/h6-7H,2-5H2,1H3,(H2,12,16)(H,14,17)(H,18,19)(H3,13,15,20)/t6?,7-/m1/s1 |
| InChIKey | UVANFNCBIDUBDB-COBSHVIPSA-N |
| XLogP | -1.39 |
| TPSA | 164.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |