C10H18N4O5S — CID 43171450
4-amino-2-[[2-(carbamoylamino)-4-methylsulfanylbutanoyl]amino]-4-oxobutanoic acid (PubChem CID 43171450) has the molecular formula C10H18N4O5S and a molecular weight of 306.34 g/mol. Its IUPAC name is 4-amino-2-[[2-(carbamoylamino)-4-methylsulfanylbutanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[2-(carbamoylamino)-4-methylsulfanylbutanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 43171450 |
| Molecular Formula | C10H18N4O5S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 4-amino-2-[[2-(carbamoylamino)-4-methylsulfanylbutanoyl]amino]-4-oxobutanoic acid |
| SMILES | CSCCC(NC(N)=O)C(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C10H18N4O5S/c1-20-3-2-5(14-10(12)19)8(16)13-6(9(17)18)4-7(11)15/h5-6H,2-4H2,1H3,(H2,11,15)(H,13,16)(H,17,18)(H3,12,14,19) |
| InChIKey | QBLHTGRSHQEYRW-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 164.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |