C10H19N3O5S — CID 107822215
(2S)-2-[[2-(carbamoylamino)-4-methylsulfanylbutanoyl]amino]-4-hydroxybutanoic acid (PubChem CID 107822215) has the molecular formula C10H19N3O5S and a molecular weight of 293.35 g/mol. Its IUPAC name is (2S)-2-[[2-(carbamoylamino)-4-methylsulfanylbutanoyl]amino]-4-hydroxybutanoic acid.
| Compound Name | (2S)-2-[[2-(carbamoylamino)-4-methylsulfanylbutanoyl]amino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107822215 |
| Molecular Formula | C10H19N3O5S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | (2S)-2-[[2-(carbamoylamino)-4-methylsulfanylbutanoyl]amino]-4-hydroxybutanoic acid |
| SMILES | CSCCC(NC(N)=O)C(=O)N[C@@H](CCO)C(=O)O |
| InChI | InChI=1S/C10H19N3O5S/c1-19-5-3-6(13-10(11)18)8(15)12-7(2-4-14)9(16)17/h6-7,14H,2-5H2,1H3,(H,12,15)(H,16,17)(H3,11,13,18)/t6?,7-/m0/s1 |
| InChIKey | BRPOMIUKABSAJS-MLWJPKLSSA-N |
| XLogP | -1.27 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |