C12H23NO8 — CID 3893142
4-methyl-2-(2,3,4,5,6-pentahydroxyhexanoylamino)pentanoic acid (PubChem CID 3893142) has the molecular formula C12H23NO8 and a molecular weight of 309.32 g/mol. Its IUPAC name is 4-methyl-2-(2,3,4,5,6-pentahydroxyhexanoylamino)pentanoic acid.
| Compound Name | 4-methyl-2-(2,3,4,5,6-pentahydroxyhexanoylamino)pentanoic acid |
|---|---|
| PubChem CID | 3893142 |
| Molecular Formula | C12H23NO8 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 4-methyl-2-(2,3,4,5,6-pentahydroxyhexanoylamino)pentanoic acid |
| SMILES | CC(C)CC(NC(=O)C(O)C(O)C(O)C(O)CO)C(=O)O |
| InChI | InChI=1S/C12H23NO8/c1-5(2)3-6(12(20)21)13-11(19)10(18)9(17)8(16)7(15)4-14/h5-10,14-18H,3-4H2,1-2H3,(H,13,19)(H,20,21) |
| InChIKey | ODWILBCFLAFDSM-UHFFFAOYSA-N |
| XLogP | -2.96 |
| TPSA | 167.55 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | -2.96 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |