C10H20FNO4 — CID 143459468
ethane;2-[(2-fluoro-2-hydroxyacetyl)amino]-4-methylpentanoic acid (PubChem CID 143459468) has the molecular formula C10H20FNO4 and a molecular weight of 237.27 g/mol. Its IUPAC name is ethane;2-[(2-fluoro-2-hydroxyacetyl)amino]-4-methylpentanoic acid.
| Compound Name | ethane;2-[(2-fluoro-2-hydroxyacetyl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 143459468 |
| Molecular Formula | C10H20FNO4 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | ethane;2-[(2-fluoro-2-hydroxyacetyl)amino]-4-methylpentanoic acid |
| SMILES | CC.CC(C)CC(NC(=O)C(O)F)C(=O)O |
| InChI | InChI=1S/C8H14FNO4.C2H6/c1-4(2)3-5(8(13)14)10-7(12)6(9)11;1-2/h4-6,11H,3H2,1-2H3,(H,10,12)(H,13,14);1-2H3 |
| InChIKey | FBQZJHTWHURWBT-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |