C13H25NO3 — CID 20766230
2-(2,3-dimethylpentanoylamino)-4-methylpentanoic acid (PubChem CID 20766230) has the molecular formula C13H25NO3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 2-(2,3-dimethylpentanoylamino)-4-methylpentanoic acid.
| Compound Name | 2-(2,3-dimethylpentanoylamino)-4-methylpentanoic acid |
|---|---|
| PubChem CID | 20766230 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | 2-(2,3-dimethylpentanoylamino)-4-methylpentanoic acid |
| SMILES | CCC(C)C(C)C(=O)NC(CC(C)C)C(=O)O |
| InChI | InChI=1S/C13H25NO3/c1-6-9(4)10(5)12(15)14-11(13(16)17)7-8(2)3/h8-11H,6-7H2,1-5H3,(H,14,15)(H,16,17) |
| InChIKey | JMVORVIVMIPTFL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |