C15H29N3O4S — CID 18221688
2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-sulfanylpropanoyl]amino]-4-methylpentanoic acid (PubChem CID 18221688) has the molecular formula C15H29N3O4S and a molecular weight of 347.48 g/mol. Its IUPAC name is 2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-sulfanylpropanoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-sulfanylpropanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 18221688 |
| Molecular Formula | C15H29N3O4S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-sulfanylpropanoyl]amino]-4-methylpentanoic acid |
| SMILES | CCC(C)C(N)C(=O)NC(CS)C(=O)NC(CC(C)C)C(=O)O |
| InChI | InChI=1S/C15H29N3O4S/c1-5-9(4)12(16)14(20)18-11(7-23)13(19)17-10(15(21)22)6-8(2)3/h8-12,23H,5-7,16H2,1-4H3,(H,17,19)(H,18,20)(H,21,22) |
| InChIKey | PPSQSIDMOVPKPI-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|