C18H35N3O4 — CID 18221781
2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-methylpentanoyl]amino]-4-methylpentanoic acid (PubChem CID 18221781) has the molecular formula C18H35N3O4 and a molecular weight of 357.50 g/mol. Its IUPAC name is 2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-methylpentanoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-methylpentanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 18221781 |
| Molecular Formula | C18H35N3O4 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.26 |
| IUPAC Name | 2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-methylpentanoyl]amino]-4-methylpentanoic acid |
| SMILES | CCC(C)C(N)C(=O)NC(C(=O)NC(CC(C)C)C(=O)O)C(C)CC |
| InChI | InChI=1S/C18H35N3O4/c1-7-11(5)14(19)16(22)21-15(12(6)8-2)17(23)20-13(18(24)25)9-10(3)4/h10-15H,7-9,19H2,1-6H3,(H,20,23)(H,21,22)(H,24,25) |
| InChIKey | TWPSALMCEHCIOY-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |