C9H20N2O4 — CID 90482817
(2S)-2-[[(2S)-2-aminopropanoyl]amino]-4-methylpentanoic acid;hydrate (PubChem CID 90482817) has the molecular formula C9H20N2O4 and a molecular weight of 220.27 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-aminopropanoyl]amino]-4-methylpentanoic acid;hydrate.
| Compound Name | (2S)-2-[[(2S)-2-aminopropanoyl]amino]-4-methylpentanoic acid;hydrate |
|---|---|
| PubChem CID | 90482817 |
| Molecular Formula | C9H20N2O4 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | (2S)-2-[[(2S)-2-aminopropanoyl]amino]-4-methylpentanoic acid;hydrate |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](C)N)C(=O)O.O |
| InChI | InChI=1S/C9H18N2O3.H2O/c1-5(2)4-7(9(13)14)11-8(12)6(3)10;/h5-7H,4,10H2,1-3H3,(H,11,12)(H,13,14);1H2/t6-,7-;/m0./s1 |
| InChIKey | XWJPUAOEGMTJOI-LEUCUCNGSA-N |
| XLogP | -0.88 |
| TPSA | 123.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |