C12H23N3O4S — CID 18218333
2-[[2-(2-aminopropanoylamino)-3-sulfanylpropanoyl]amino]-4-methylpentanoic acid (PubChem CID 18218333) has the molecular formula C12H23N3O4S and a molecular weight of 305.40 g/mol. Its IUPAC name is 2-[[2-(2-aminopropanoylamino)-3-sulfanylpropanoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-(2-aminopropanoylamino)-3-sulfanylpropanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 18218333 |
| Molecular Formula | C12H23N3O4S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 2-[[2-(2-aminopropanoylamino)-3-sulfanylpropanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)C(CS)NC(=O)C(C)N)C(=O)O |
| InChI | InChI=1S/C12H23N3O4S/c1-6(2)4-8(12(18)19)14-11(17)9(5-20)15-10(16)7(3)13/h6-9,20H,4-5,13H2,1-3H3,(H,14,17)(H,15,16)(H,18,19) |
| InChIKey | CXZFXHGJJPVUJE-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|