C28H55NO10 — CID 175321766
hexadecanoic acid;4-methyl-2-(2,3,4,5,6-pentahydroxyhexanoylamino)pentanoic acid (PubChem CID 175321766) has the molecular formula C28H55NO10 and a molecular weight of 565.75 g/mol. Its IUPAC name is hexadecanoic acid;4-methyl-2-(2,3,4,5,6-pentahydroxyhexanoylamino)pentanoic acid.
| Compound Name | hexadecanoic acid;4-methyl-2-(2,3,4,5,6-pentahydroxyhexanoylamino)pentanoic acid |
|---|---|
| PubChem CID | 175321766 |
| Molecular Formula | C28H55NO10 |
| Molecular Weight | 565.75 g/mol |
| Exact Mass | 565.38 |
| IUPAC Name | hexadecanoic acid;4-methyl-2-(2,3,4,5,6-pentahydroxyhexanoylamino)pentanoic acid |
| SMILES | CC(C)CC(NC(=O)C(O)C(O)C(O)C(O)CO)C(=O)O.CCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C16H32O2.C12H23NO8/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;1-5(2)3-6(12(20)21)13-11(19)10(18)9(17)8(16)7(15)4-14/h2-15H2,1H3,(H,17,18);5-10,14-18H,3-4H2,1-2H3,(H,13,19)(H,20,21) |
| InChIKey | QHBXXZCNWOLUHJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 204.85 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.75 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|