C13H25NO7 — CID 141113311
N-[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]heptanamide (PubChem CID 141113311) has the molecular formula C13H25NO7 and a molecular weight of 307.34 g/mol. Its IUPAC name is N-[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]heptanamide.
| Compound Name | N-[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]heptanamide |
|---|---|
| PubChem CID | 141113311 |
| Molecular Formula | C13H25NO7 |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | N-[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]heptanamide |
| SMILES | CCCCCCC(=O)NC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C13H25NO7/c1-2-3-4-5-6-9(17)14-13(21)12(20)11(19)10(18)8(16)7-15/h8,10-12,15-16,18-20H,2-7H2,1H3,(H,14,17,21)/t8-,10-,11+,12-/m1/s1 |
| InChIKey | JGOFXSAIGOBHKU-KXGXSXBTSA-N |
| XLogP | -1.96 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|