C11H23NO6 — CID 135157558
2,3,4,5,6-pentahydroxy-N-(3-methylbutyl)hexanamide (PubChem CID 135157558) has the molecular formula C11H23NO6 and a molecular weight of 265.31 g/mol. Its IUPAC name is 2,3,4,5,6-pentahydroxy-N-(3-methylbutyl)hexanamide.
| Compound Name | 2,3,4,5,6-pentahydroxy-N-(3-methylbutyl)hexanamide |
|---|---|
| PubChem CID | 135157558 |
| Molecular Formula | C11H23NO6 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 2,3,4,5,6-pentahydroxy-N-(3-methylbutyl)hexanamide |
| SMILES | CC(C)CCNC(=O)C(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C11H23NO6/c1-6(2)3-4-12-11(18)10(17)9(16)8(15)7(14)5-13/h6-10,13-17H,3-5H2,1-2H3,(H,12,18) |
| InChIKey | BLUSMBBXZQGVBK-UHFFFAOYSA-N |
| XLogP | -2.42 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |