C13H29N2O7+ — CID 18635688
hydroxy-dimethyl-[5-[[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]pentan-2-yl]azanium (PubChem CID 18635688) has the molecular formula C13H29N2O7+ and a molecular weight of 325.38 g/mol. Its IUPAC name is hydroxy-dimethyl-[5-[[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]pentan-2-yl]azanium.
| Compound Name | hydroxy-dimethyl-[5-[[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]pentan-2-yl]azanium |
|---|---|
| PubChem CID | 18635688 |
| Molecular Formula | C13H29N2O7+ |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | hydroxy-dimethyl-[5-[[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]pentan-2-yl]azanium |
| SMILES | CC(CCCNC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)[N+](C)(C)O |
| InChI | InChI=1S/C13H28N2O7/c1-8(15(2,3)22)5-4-6-14-13(21)12(20)11(19)10(18)9(17)7-16/h8-12,16-20,22H,4-7H2,1-3H3/p+1/t8?,9-,10-,11+,12-/m1/s1 |
| InChIKey | JCGMMAZDZFMAMM-IPDPYQKTSA-O |
| XLogP | -2.83 |
| TPSA | 150.48 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|