C10H20N2O7 — CID 10564681
(2R,3S,4S,5S)-6-(4-aminobutylamino)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid (PubChem CID 10564681) has the molecular formula C10H20N2O7 and a molecular weight of 280.28 g/mol. Its IUPAC name is (2R,3S,4S,5S)-6-(4-aminobutylamino)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid.
| Compound Name | (2R,3S,4S,5S)-6-(4-aminobutylamino)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid |
|---|---|
| PubChem CID | 10564681 |
| Molecular Formula | C10H20N2O7 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (2R,3S,4S,5S)-6-(4-aminobutylamino)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid |
| SMILES | NCCCCNC(=O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C10H20N2O7/c11-3-1-2-4-12-9(17)7(15)5(13)6(14)8(16)10(18)19/h5-8,13-16H,1-4,11H2,(H,12,17)(H,18,19)/t5-,6-,7-,8+/m0/s1 |
| InChIKey | YOYZDDFJZRSZLR-DKXJUACHSA-N |
| XLogP | -3.63 |
| TPSA | 173.34 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -3.63 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|