C10H22N4O6 — CID 59188977
(2S,3R,4S,5R)-N,N'-bis(2-aminoethyl)-2,3,4,5-tetrahydroxyhexanediamide (PubChem CID 59188977) has the molecular formula C10H22N4O6 and a molecular weight of 294.31 g/mol. Its IUPAC name is (2S,3R,4S,5R)-N,N'-bis(2-aminoethyl)-2,3,4,5-tetrahydroxyhexanediamide.
| Compound Name | (2S,3R,4S,5R)-N,N'-bis(2-aminoethyl)-2,3,4,5-tetrahydroxyhexanediamide |
|---|---|
| PubChem CID | 59188977 |
| Molecular Formula | C10H22N4O6 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | (2S,3R,4S,5R)-N,N'-bis(2-aminoethyl)-2,3,4,5-tetrahydroxyhexanediamide |
| SMILES | NCCNC(=O)[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)C(=O)NCCN |
| InChI | InChI=1S/C10H22N4O6/c11-1-3-13-9(19)7(17)5(15)6(16)8(18)10(20)14-4-2-12/h5-8,15-18H,1-4,11-12H2,(H,13,19)(H,14,20)/t5-,6+,7+,8- |
| InChIKey | SDSCTTIPDLNOAW-SOSBWXJGSA-N |
| XLogP | -5.42 |
| TPSA | 191.16 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | -5.42 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |