C11H23N3O7 — CID 88892403
(2R,3S,4S,5S)-N-[2-(2-aminoethylamino)ethyl]-2,3,4,5,7-pentahydroxy-6-oxoheptanamide (PubChem CID 88892403) has the molecular formula C11H23N3O7 and a molecular weight of 309.32 g/mol. Its IUPAC name is (2R,3S,4S,5S)-N-[2-(2-aminoethylamino)ethyl]-2,3,4,5,7-pentahydroxy-6-oxoheptanamide.
| Compound Name | (2R,3S,4S,5S)-N-[2-(2-aminoethylamino)ethyl]-2,3,4,5,7-pentahydroxy-6-oxoheptanamide |
|---|---|
| PubChem CID | 88892403 |
| Molecular Formula | C11H23N3O7 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | (2R,3S,4S,5S)-N-[2-(2-aminoethylamino)ethyl]-2,3,4,5,7-pentahydroxy-6-oxoheptanamide |
| SMILES | NCCNCCNC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)C(=O)CO |
| InChI | InChI=1S/C11H23N3O7/c12-1-2-13-3-4-14-11(21)10(20)9(19)8(18)7(17)6(16)5-15/h7-10,13,15,17-20H,1-5,12H2,(H,14,21)/t7-,8-,9+,10-/m1/s1 |
| InChIKey | HRVDBYAZEPXHTH-DOLQZWNJSA-N |
| XLogP | -5.34 |
| TPSA | 185.37 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | -5.34 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|