C11H23N3O6 — CID 91190770
N-(2-aminoethyl)-2,3,4,5-tetrahydroxy-N'-propylhexanediamide (PubChem CID 91190770) has the molecular formula C11H23N3O6 and a molecular weight of 293.32 g/mol. Its IUPAC name is N-(2-aminoethyl)-2,3,4,5-tetrahydroxy-N'-propylhexanediamide.
| Compound Name | N-(2-aminoethyl)-2,3,4,5-tetrahydroxy-N'-propylhexanediamide |
|---|---|
| PubChem CID | 91190770 |
| Molecular Formula | C11H23N3O6 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | N-(2-aminoethyl)-2,3,4,5-tetrahydroxy-N'-propylhexanediamide |
| SMILES | CCCNC(=O)C(O)C(O)C(O)C(O)C(=O)NCCN |
| InChI | InChI=1S/C11H23N3O6/c1-2-4-13-10(19)8(17)6(15)7(16)9(18)11(20)14-5-3-12/h6-9,15-18H,2-5,12H2,1H3,(H,13,19)(H,14,20) |
| InChIKey | UDOJQEPEQSLZSA-UHFFFAOYSA-N |
| XLogP | -3.97 |
| TPSA | 165.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | -3.97 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |