C17H38N6O7 — CID 88953763
methyl (2S,3S,4S,5R)-6-[2-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethylamino]ethylamino]-2,3,4,5-tetrahydroxy-6-oxohexanoate (PubChem CID 88953763) has the molecular formula C17H38N6O7 and a molecular weight of 438.53 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R)-6-[2-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethylamino]ethylamino]-2,3,4,5-tetrahydroxy-6-oxohexanoate.
| Compound Name | methyl (2S,3S,4S,5R)-6-[2-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethylamino]ethylamino]-2,3,4,5-tetrahydroxy-6-oxohexanoate |
|---|---|
| PubChem CID | 88953763 |
| Molecular Formula | C17H38N6O7 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | methyl (2S,3S,4S,5R)-6-[2-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethylamino]ethylamino]-2,3,4,5-tetrahydroxy-6-oxohexanoate |
| SMILES | COC(=O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)NCCNCCNCCNCCNCCN |
| InChI | InChI=1S/C17H38N6O7/c1-30-17(29)15(27)13(25)12(24)14(26)16(28)23-11-10-22-9-8-21-7-6-20-5-4-19-3-2-18/h12-15,19-22,24-27H,2-11,18H2,1H3,(H,23,28)/t12-,13-,14+,15-/m0/s1 |
| InChIKey | YXPGCLQGIVSKFQ-XQLPTFJDSA-N |
| XLogP | -5.96 |
| TPSA | 210.46 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | -5.96 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|