C7H19N5O — CID 175595434
2-[2-(2-aminoethylamino)ethylamino]ethylurea (PubChem CID 175595434) has the molecular formula C7H19N5O and a molecular weight of 189.26 g/mol. Its IUPAC name is 2-[2-(2-aminoethylamino)ethylamino]ethylurea.
| Compound Name | 2-[2-(2-aminoethylamino)ethylamino]ethylurea |
|---|---|
| PubChem CID | 175595434 |
| Molecular Formula | C7H19N5O |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.16 |
| IUPAC Name | 2-[2-(2-aminoethylamino)ethylamino]ethylurea |
| SMILES | NCCNCCNCCNC(N)=O |
| InChI | InChI=1S/C7H19N5O/c8-1-2-10-3-4-11-5-6-12-7(9)13/h10-11H,1-6,8H2,(H3,9,12,13) |
| InChIKey | KCMLOHFGRCXJPJ-UHFFFAOYSA-N |
| XLogP | -2.21 |
| TPSA | 105.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|